Bioactive Compound Details
| Compound ID: | B164945 |
| Source ID: | CHEMBL102025 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C11H12FN3O2S |
| SMILES: | O=S1(=O)NC(NC2CCC2)=Nc2ccc(F)cc21 |
| Molecular Species: | ACID |

| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|