Bioactive Compound Details
| Compound ID: | B2074913 |
| Source ID: | CHEMBL3781094 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C22H19N7 |
| SMILES: | N#Cc1ccccc1N1CCN(c2ncnc3c2cnn3-c2ccccc2)CC1 |
| Molecular Species: | NEUTRAL |

| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name | |
|---|---|---|---|---|---|---|---|
| T24 | Solute carrier family 2, facilitated glucose transporter member 2 | SLC2A2 | Target is a single protein chain | P11168 | SLC2A2_HUMAN | Details | |
| T24 | Solute carrier family 2, facilitated glucose transporter member 2 | SLC2A2 | Target is a single protein chain | P11168 | SLC2A2_HUMAN | Details |