Bioactive Compound Details
| Compound ID: | B476335 |
| Source ID: | CHEMBL475623 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C11H6N4O3S |
| SMILES: | O=[N+]([O-])c1cc(-c2nc(-c3ccccn3)no2)cs1 |
| Molecular Species: | NEUTRAL |
| Compound ID: | B476335 |
| Source ID: | CHEMBL475623 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C11H6N4O3S |
| SMILES: | O=[N+]([O-])c1cc(-c2nc(-c3ccccn3)no2)cs1 |
| Molecular Species: | NEUTRAL |