Bioactive Compound Details
| Compound ID: | B816199 |
| Source ID: | CHEMBL1392315 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C17H16N2O3S2 |
| SMILES: | O=c1c2ccccc2sn1-c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| Molecular Species: |
| Compound ID: | B816199 |
| Source ID: | CHEMBL1392315 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C17H16N2O3S2 |
| SMILES: | O=c1c2ccccc2sn1-c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| Molecular Species: |