Investigational Drug Details
| Drug ID: | D342 |
| Drug Name: | Ofloxacin |
| Synonyms: | |
| Type: | small molecule |
| DrugBank ID: | DB01165 |
| DrugBank Description: | A synthetic fluoroquinolone (fluoroquinolones) antibacterial agent that inhibits the supercoiling activity of bacterial DNA gyrase, halting DNA replication. |
| PubChem ID: | 4583 |
| CasNo: | 82419-36-1 |
| Repositioning for NAFLD: | Yes |
| SMILES: | CC1COC2=C3N1C=C(C(O)=O)C(=O)C3=CC(F)=C2N1CCN(C)CC1 |
| Structure: |
|
| InChiKey: | GSDSWSVVBLHKDQ-UHFFFAOYSA-N |
| Molecular Weight: | 361.3675 |
| DrugBank Targets: | DNA gyrase subunit A; DNA topoisomerase 4 subunit A; DNA topoisomerase 2-alpha |
| DrugBank MoA: | Ofloxacin acts on DNA gyrase and toposiomerase IV, enzymes which, like human topoisomerase, prevents the excessive supercoiling of DNA during replication or transcription. By inhibiting their function, the drug thereby inhibits normal cell division. |
| DrugBank Pharmacology: | Ofloxacin is a quinolone/fluoroquinolone antibiotic. Ofloxacin is bactericidal and its mode of action depends on blocking of bacterial DNA replication by binding itself to an enzyme called DNA gyrase, which allows the untwisting required to replicate one DNA double helix into two. Notably the drug has 100 times higher affinity for bacterial DNA gyrase than for mammalian. Ofloxacin is a broad-spectrum antibiotic that is active against both Gram-positive and Gram-negative bacteria. |
| DrugBank Indication: | For the treatment of infections (respiratory tract, kidney, skin, soft tissue, UTI), urethral and cervical gonorrhoea. |
| Targets: | |
| Therapeutic Category: | |
| Clinical Trial Progress: | |
| Latest Progress: |
| Trial ID | Source ID | Phases | Status | Study Results | Start Date | Last Update Posted | |
|---|---|---|---|---|---|---|---|
| L2982 | NCT01195662 | PHASE3 | COMPLETED | YES | 2010-10 | 2016-12-29 | Details |
| L3185 | NCT01497574 | PHASE1 | COMPLETED | NO | 2005-05 | 2017-01-30 | Details |
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Article ID | PMID | Source | Title |
|---|