Natural Product Details
Structure:
| Product ID: | N01069 |
| Product Name: | 3,3',5'-triiodothyronine |
| CAS No: | |
| Molecular Formula: | C15H12I3NO4 |
| SMILES: | C1=CC(=C(C=C1CC(C(=O)O)N)I)OC2=CC(=C(C(=C2)I)O)I |
| InChiKey: | |
| Category: | |
| Biological Source: |
