Natural Product Details
Structure:
| Product ID: | N01096 |
| Product Name: | (-)-Chimonanthine |
| CAS No: | 5545 |
| Molecular Formula: | C22H26N4 |
| SMILES: | CN1CCC2(C1NC3=CC=CC=C32)C45CCN(C4NC6=CC=CC=C56)C |
| InChiKey: | |
| Category: | |
| Biological Source: |
