Natural Product Details
Structure:
| Product ID: | N01277 |
| Product Name: | foeniculoside v |
| CAS No: | 174232 |
| Molecular Formula: | C16H28O8 |
| SMILES: | CC1(C2(CCC(O1)(C(C2)OC3C(C(C(C(O3)CO)O)O)O)C)O)C |
| InChiKey: | |
| Category: | |
| Biological Source: |
