Natural Product Details
Structure:
| Product ID: | N01315 |
| Product Name: | 4-tridecanone |
| CAS No: | |
| Molecular Formula: | C13H26O |
| SMILES: | C([H])([H])([H])C([H])([H])C([H])([H])C(=O)C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] |
| InChiKey: | |
| Category: | |
| Biological Source: |
