Natural Product Details
Structure:
| Product ID: | N01380 |
| Product Name: | aristol-1(10)-en-12-al |
| CAS No: | |
| Molecular Formula: | C15H22O |
| SMILES: | CC1CCC(=O)C2C1(C3C(C3(C)C)C=C2)C |
| InChiKey: | |
| Category: | |
| Biological Source: |
