Natural Product Details
Structure:
| Product ID: | N01395 |
| Product Name: | poncirin |
| CAS No: | 14941 |
| Molecular Formula: | C28H34O14 |
| SMILES: | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC=C(C=C5)OC)O)CO)O)O)O)O)O |
| InChiKey: | |
| Category: | |
| Biological Source: |
