Natural Product Details
Structure:
| Product ID: | N01457 |
| Product Name: | arachidonic acid |
| CAS No: | 93444 |
| Molecular Formula: | C20H32O2 |
| SMILES: | CCCCCC=CCC=CCC=CCC=CCCCC(=O)O |
| InChiKey: | |
| Category: | |
| Biological Source: |
