Natural Product Details
                      
                      Structure:
                         
                      
                  
                  | Product ID: | N01469 | 
| Product Name: | delta 5-Pregnenetriol | 
| CAS No: | 903 | 
| Molecular Formula: | C21H34O3 | 
| SMILES: | CC(C1(CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)O)O | 
| InChiKey: | |
| Category: | |
| Biological Source: | 
 
     
  