Natural Product Details
                      
                      Structure:
                         
                      
                  
                  | Product ID: | N01500 | 
| Product Name: | ent-11α,18-diacetoxy-7β-hydroxykaur-16-en-15-one | 
| CAS No: | |
| Molecular Formula: | C24H34O6 | 
| SMILES: | CC(=O)OCC1(CCCC2(C1CC(C34C2C(CC(C3)C(=C)C4=O)OC(=O)C)O)C)C | 
| InChiKey: | |
| Category: | |
| Biological Source: | 
 
     
  