Natural Product Details
Structure:
| Product ID: | N00026 |
| Product Name: | taxol |
| CAS No: | 33069 |
| Molecular Formula: | C47H51NO14 |
| SMILES: | CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C |
| InChiKey: | |
| Category: | |
| Biological Source: |
