Natural Product Details
Structure:
| Product ID: | N00317 |
| Product Name: | (+)-4-hydroxy-2,6-di(3,4-dimethoxy)phenyl-3,7-dioxabicyclo[3.3.0]octane |
| CAS No: | |
| Molecular Formula: | C22H26O7 |
| SMILES: | COC1=C(C=C(C=C1)C2C3COC(C3C(O2)O)C4=CC(=C(C=C4)OC)OC)OC |
| InChiKey: | |
| Category: | |
| Biological Source: |
