Natural Product Details
Structure:
| Product ID: | N00336 |
| Product Name: | (2s,2''s)-7,7''-di-o-methyltetrahydroamento-flavone |
| CAS No: | |
| Molecular Formula: | C32H26O10 |
| SMILES: | COC1=CC(=C2C(=O)CC(OC2=C1)C3=CC(=C(C=C3)O)C4=C(C=C(C5=C4OC(CC5=O)C6=CC=C(C=C6)O)O)OC)O |
| InChiKey: | |
| Category: | |
| Biological Source: |
