Natural Product Details
Structure:
| Product ID: | N00651 |
| Product Name: | 7,10,13-Hexadecatrienoic acid, methyl ester |
| CAS No: | |
| Molecular Formula: | C17H28O2 |
| SMILES: | CCC=CCC=CCC=CCCCCCC(=O)OC |
| InChiKey: | |
| Category: | |
| Biological Source: |
