Natural Product Details
Structure:
| Product ID: | N00674 |
| Product Name: | Bicyclo[6.3.0]undeca-1,7-dien-3-one, 5,5-dimethyl- |
| CAS No: | |
| Molecular Formula: | C13H18O |
| SMILES: | CC1(CC=C2CCCC2=CC(=O)C1)C |
| InChiKey: | |
| Category: | |
| Biological Source: |
