Natural Product Details
Structure:
| Product ID: | N00682 |
| Product Name: | n,n-dimethyltryptamine-methohydroxide |
| CAS No: | |
| Molecular Formula: | C13H20N2O |
| SMILES: | C[N+](C)(C)CCC1=CNC2=CC=CC=C21.[OH-] |
| InChiKey: | |
| Category: | |
| Biological Source: |
