Natural Product Details
Structure:
| Product ID: | N00080 |
| Product Name: | dehydrocostus lactone |
| CAS No: | 477 |
| Molecular Formula: | C15H18O2 |
| SMILES: | C=C1CCC2C(C3C1CCC3=C)OC(=O)C2=C |
| InChiKey: | |
| Category: | |
| Biological Source: |
