Natural Product Details
Structure:
| Product ID: | N00848 |
| Product Name: | LC 5504 |
| CAS No: | 132922 |
| Molecular Formula: | C20H30O3 |
| SMILES: | CC1C(=O)CC2C(CCCC2(C13CCC4(O3)COC=C4)C)(C)C |
| InChiKey: | |
| Category: | |
| Biological Source: |
