Natural Product Details
Structure:
| Product ID: | N00104 |
| Product Name: | oleandrin |
| CAS No: | 465 |
| Molecular Formula: | C32H48O9 |
| SMILES: | CC1C(C(CC(O1)OC2CCC3(C(C2)CCC4C3CCC5(C4(CC(C5C6=CC(=O)OC6)OC(=O)C)O)C)C)OC)O |
| InChiKey: | |
| Category: | |
| Biological Source: |
