Natural Product Details
Structure:
| Product ID: | N00114 |
| Product Name: | cneorin-NP36 |
| CAS No: | 116696 |
| Molecular Formula: | C30H46O3 |
| SMILES: | CC(C1CCC2(C1(CCC3C2=CCC4C3(CCC(=O)C4(C)C)C)C)C)C5C(O5)C6C(O6)(C)C |
| InChiKey: | |
| Category: | |
| Biological Source: |
