Natural Product Details
Structure:
| Product ID: | N01252 |
| Product Name: | 2-(4-cyclohexylphenoxy)ethanol |
| CAS No: | 28761 |
| Molecular Formula: | C14H20O2 |
| SMILES: | C1CCC(CC1)C2=CC=C(C=C2)OCCO |
| InChiKey: | |
| Category: | |
| Biological Source: |
