Natural Product Details
Structure:
| Product ID: | N01299 |
| Product Name: | cannabiripsol |
| CAS No: | 72236 |
| Molecular Formula: | C21H32O4 |
| SMILES: | CCCCCC1=CC(=C2C3C(CCC(C3O)(C)O)C(OC2=C1)(C)C)O |
| InChiKey: | |
| Category: | |
| Biological Source: |
