Natural Product Details
Structure:
| Product ID: | N01407 |
| Product Name: | Diazinon |
| CAS No: | |
| Molecular Formula: | C12H21N2O3PS |
| SMILES: | c1([H])c(C([H])([H])[H])nc(C([H])(C([H])([H])[H])C([H])([H])[H])nc1OP(OC([H])([H])C([H])([H])[H])(OC([H])([H])C([H])([H])[H])=S |
| InChiKey: | |
| Category: | |
| Biological Source: |
