Natural Product Details
Structure:
| Product ID: | N01425 |
| Product Name: | azedarachin c |
| CAS No: | 157653 |
| Molecular Formula: | C32H42O10 |
| SMILES: | CC(C)C(=O)OC1C2(C3CC(C4(C(C3(CO1)C(CC2OC(=O)C)O)C(=O)CC5(C46C(O6)CC5C7=COC=C7)C)C)O)C |
| InChiKey: | |
| Category: | |
| Biological Source: |
