Natural Product Details
Structure:
| Product ID: | N01469 |
| Product Name: | delta 5-Pregnenetriol |
| CAS No: | 903 |
| Molecular Formula: | C21H34O3 |
| SMILES: | CC(C1(CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)O)O |
| InChiKey: | |
| Category: | |
| Biological Source: |
