Natural Product Details
Structure:
| Product ID: | N01494 |
| Product Name: | [(1S,3R)-1-[(2R)-3,3-dimethyloxiran-2-yl]-3-[(5R,8S,9S,10S,11S,14R)-11-hydroxy-4,4,8,10,14-pentamethyl-3-oxo-1,2,5,6,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-yl]butyl] acetate |
| CAS No: | 19865 |
| Molecular Formula: | C32H50O5 |
| SMILES: | CC(CC(C1C(O1)(C)C)OC(=O)C)C2=C3CC(C4C5(CCC(=O)C(C5CCC4(C3(CC2)C)C)(C)C)C)O |
| InChiKey: | |
| Category: | |
| Biological Source: |
