Natural Product Details
Structure:
| Product ID: | N01580 |
| Product Name: | Pteleprenine |
| CAS No: | 17232 |
| Molecular Formula: | C17H19NO4 |
| SMILES: | CC(=CCC1=C(C2=C(C3=C(C=C2)OCO3)N(C1=O)C)OC)C |
| InChiKey: | |
| Category: | |
| Biological Source: |
