Natural Product Details
Structure:
| Product ID: | N01588 |
| Product Name: | Teucvin |
| CAS No: | 51918 |
| Molecular Formula: | C19H20O5 |
| SMILES: | CC1CC2C3=C(CCCC3C14CC(OC4=O)C5=COC=C5)C(=O)O2 |
| InChiKey: | |
| Category: | |
| Biological Source: |
