Natural Product Details
Structure:
| Product ID: | N00231 |
| Product Name: | 1,8-dihydroxy-3-(3'-hydroxy-butoxy)xanthone |
| CAS No: | |
| Molecular Formula: | C17H16O6 |
| SMILES: | CC(CCOC1=CC(=C2C(=C1)OC3=C(C2=O)C(=CC=C3)O)O)O |
| InChiKey: | |
| Category: | |
| Biological Source: |
