Natural Product Details
Structure:
| Product ID: | N00235 |
| Product Name: | 6-isopropenyl-4,4a-dimethyl-1,2,3,4,4a,5,6,7-octahydro-naphthalen-1-ol |
| CAS No: | |
| Molecular Formula: | C15H24O |
| SMILES: | CC1CCC(C2=CCC(CC12C)C(=C)C)O |
| InChiKey: | |
| Category: | |
| Biological Source: |
