Natural Product Details
Structure:
| Product ID: | N00293 |
| Product Name: | 9-Ethoxyaristolactone |
| CAS No: | 122739 |
| Molecular Formula: | C19H14O6 |
| SMILES: | CCOC1=C2C3=C(C4=C1C(=CC=C4)OC)C5=C(C=C3C(=O)O2)OCO5 |
| InChiKey: | |
| Category: | |
| Biological Source: |
