Natural Product Details
Structure:
| Product ID: | N00296 |
| Product Name: | ganoderic acid M |
| CAS No: | 110311 |
| Molecular Formula: | C30H42O8 |
| SMILES: | CC(CC(=O)CC(C)C(=O)O)C1CC(=O)C2(C1(C(C(=O)C3=C2C(CC4C3(CCC(=O)C4(C)C)C)O)O)C)C |
| InChiKey: | |
| Category: | |
| Biological Source: |
