Natural Product Details
Structure:
| Product ID: | N00356 |
| Product Name: | cryptoxanthin 5,6:5',8'-diepoxide |
| CAS No: | 55965 |
| Molecular Formula: | C40H56O3 |
| SMILES: | CC(=CC=CC=C(C)C=CC=C(C)C1C=C2C(CCCC2(O1)C)(C)C)C=CC=C(C)C=CC34C(CC(CC3(O4)C)O)(C)C |
| InChiKey: | |
| Category: | |
| Biological Source: |
