Natural Product Details
Structure:
| Product ID: | N00506 |
| Product Name: | 2,5-bis(1-methyl-1-silacyclobutyl)-p-xylene |
| CAS No: | |
| Molecular Formula: | C16H26Si2 |
| SMILES: | CC1=CC(=C(C=C1[Si]2(CCC2)C)C)[Si]3(CCC3)C |
| InChiKey: | |
| Category: | |
| Biological Source: |
