Natural Product Details
Structure:
| Product ID: | N00727 |
| Product Name: | 3-trans-p-coumaroylrotundic acid |
| CAS No: | 144624 |
| Molecular Formula: | C39H54O7 |
| SMILES: | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)CO)OC(=O)C=CC6=CC=C(C=C6)O)C)C)C2C1(C)O)C)C(=O)O |
| InChiKey: | |
| Category: | |
| Biological Source: |
