Bioactive Compound Details
| Compound ID: | B2040640 |
| Source ID: | CHEMBL3718049 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C25H28O5 |
| SMILES: | CCOc1cc2c(cc1C(=O)c1ccc(C(=O)C(=O)O)cc1)C(C)(C)CCC2(C)C |
| Molecular Species: | ACID |
| Compound ID: | B2040640 |
| Source ID: | CHEMBL3718049 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C25H28O5 |
| SMILES: | CCOc1cc2c(cc1C(=O)c1ccc(C(=O)C(=O)O)cc1)C(C)(C)CCC2(C)C |
| Molecular Species: | ACID |