Bioactive Compound Details
| Compound ID: | B301528 |
| Source ID: | CHEMBL180858 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C16H18ClN3O4S2 |
| SMILES: | CS(=O)(=O)c1ccc(N(CC2CCCO2)C(=O)Nc2ncc(Cl)s2)cc1 |
| Molecular Species: | NEUTRAL |
| Compound ID: | B301528 |
| Source ID: | CHEMBL180858 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C16H18ClN3O4S2 |
| SMILES: | CS(=O)(=O)c1ccc(N(CC2CCCO2)C(=O)Nc2ncc(Cl)s2)cc1 |
| Molecular Species: | NEUTRAL |