Bioactive Compound Details
| Compound ID: | B500054 |
| Source ID: | CHEMBL491458 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C28H32N8O3 |
| SMILES: | Nc1nc(N2CCCCC2)nc2c1c(=O)c(C(=O)NCc1ccc(-n3ccnc3)cc1)cn2CC1CCCO1 |
| Molecular Species: | NEUTRAL |
