Bioactive Compound Details
| Compound ID: | B763033 |
| Source ID: | CHEMBL1339149 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C15H14N2O3S2 |
| SMILES: | CN(C)S(=O)(=O)c1cccc(-n2sc3ccccc3c2=O)c1 |
| Molecular Species: |

| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name | |
|---|---|---|---|---|---|---|---|
| T36 | Mitochondrial glycerol-3-phosphate dehydrogenase | GPD2 | INHIBITOR | Oxidoreductase | P43304 | GPD2_HUMAN | Details |
| T19 | Hexokinase type IV | GCK | ACTIVATOR | Target is a single protein chain | P35557 | GCK_HUMAN | Details |
| T27 | Phosphomannomutase 2 | PMM2 | Isomerase | O15305 | PMM2_HUMAN | Details | |
| T27 | Phosphomannomutase 2 | PMM2 | Isomerase | O15305 | PMM2_HUMAN | Details | |
| T27 | Phosphomannomutase 2 | PMM2 | Isomerase | O15305 | PMM2_HUMAN | Details |