Bioactive Compound Details
| Compound ID: | B301520 |
| Source ID: | CHEMBL359665 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C22H25N3O5S3 |
| SMILES: | CS(=O)(=O)c1ccc(N(CC2CCCC2)C(=O)Nc2nc3ccc(S(C)(=O)=O)cc3s2)cc1 |
| Molecular Species: | NEUTRAL |
