Bioactive Compound Details
| Compound ID: | B000323 |
| Source ID: | CHEMBL6857 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C11H11BrN2 |
| SMILES: | Brc1cccc2c3c([nH]c12)CNCC3 |
| Molecular Species: | BASE |
| Compound ID: | B000323 |
| Source ID: | CHEMBL6857 |
| Source Type: | Small molecule |
| Compound Name: | |
| Synonyms: | |
| Molecular Formula: | C11H11BrN2 |
| SMILES: | Brc1cccc2c3c([nH]c12)CNCC3 |
| Molecular Species: | BASE |