Natural Product Details
Structure:
| Product ID: | N00311 |
| Product Name: | acetylsoyasaponin a4 |
| CAS No: | 117230 |
| Molecular Formula: | C64H100O31 |
| SMILES: | CC(=O)OC1COC(C(C1OC(=O)C)OC(=O)C)OC2C(COC(C2O)OC3C(C(CC4C3(CCC5(C4=CCC6C5(CCC7C6(CCC(C7(C)CO)OC8C(C(C(C(O8)C(=O)O)O)O)OC9C(C(C(C(O9)CO)O)O)OC1C(C(C(C(O1)CO)O)O)O)C)C)C)C)(C)C)O)O |
| InChiKey: | |
| Category: | |
| Biological Source: |
