Natural Product Details
Structure:
| Product ID: | N00950 |
| Product Name: | (5S)-5,9-dihydroxy-4-(4-hydroxyphenyl)-5,6-dihydro-1-benzoxocin-2-one |
| CAS No: | 126617 |
| Molecular Formula: | C23H24O10 |
| SMILES: | C1C(C(=CC(=O)OC2=C1C=CC(=C2)O)C3=CC=C(C=C3)O)O |
| InChiKey: | |
| Category: | |
| Biological Source: |
