Bioactive Compound Details
| Compound ID: | B003666 |
| Source ID: | CHEMBL50 |
| Source Type: | Small molecule |
| Compound Name: | QUERCETIN |
| Synonyms: | C.I. Natural Red 1|3'-hydroxykaempferol|C.i. 75670|Ci-75670|Corvitin|Cyanidenolon 1522|Korvitin|LDN 0052529|LDN-0052529|Lipoflavon|Meletin|NSC 57655|NSC 9219|NSC-57655|NSC-9219|Quercetin|Quercetin|Quercetin|Quercetin (constituent of ginkgo)|Quercetine|Quercetol|Quertin|Quertine|Sophoretin|Xanthaurine |
| Molecular Formula: | C15H10O7 |
| SMILES: | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| Molecular Species: | ACID |

| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name | |
|---|---|---|---|---|---|---|---|
| T09 | Serine/threonine-protein kinase AKT2 | AKT2 | INHIBITOR | Target is a single protein chain | P31751 | AKT2_HUMAN | Details |
| T09 | Serine/threonine-protein kinase AKT2 | AKT2 | INHIBITOR | Target is a single protein chain | P31751 | AKT2_HUMAN | Details |
| T24 | Solute carrier family 2, facilitated glucose transporter member 2 | SLC2A2 | Target is a single protein chain | P11168 | SLC2A2_HUMAN | Details | |
| T19 | Hexokinase type IV | GCK | ACTIVATOR | Target is a single protein chain | P35557 | GCK_HUMAN | Details |
| T17 | Protein-tyrosine phosphatase 1B | PTPN1 | Target is a single protein chain | P18031 | PTPN1_HUMAN | Details | |
| T25 | Solute carrier family 2, facilitated glucose transporter member 4 | SLC2A4 | Target is a single protein chain | P14672 | SLC2A4_HUMAN | Details | |
| T17 | Protein-tyrosine phosphatase 1B | PTPN1 | Target is a single protein chain | P18031 | PTPN1_HUMAN | Details | |
| T24 | Solute carrier family 2, facilitated glucose transporter member 2 | SLC2A2 | Target is a single protein chain | P11168 | SLC2A2_HUMAN | Details |